missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Chlorogensäure, überwiegend trans, aus Kaffeesamen, 98 %
97.18 € - 242.21 €
Chemische Identifikatoren
| CAS | 327-97-9 |
|---|---|
| Summenformel | C16H18O9 |
| Molekulargewicht (g/mol) | 354.31 |
| MDL-Nummer | MFCD00003862 |
| InChI-Schlüssel | CWVRJTMFETXNAD-JUHZACGLSA-N |
| Synonym | chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri |
| PubChem CID | 1794427 |
| ChEBI | CHEBI:16112 |
| IUPAC-Name | (1S,3R,4R,5R)-3-[(E)-3-(3,4-Dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-Trihydroxycyclohexan-1-Carbonsäure |
| SMILES | O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O |
| Produktcode | Marke | Menge | Verpackung | Preis | Menge & Verfügbarkeit | ||||
|---|---|---|---|---|---|---|---|---|---|
| Produktcode | Marke | Menge | Verpackung | Preis | Menge & Verfügbarkeit | ||||
|
10487670
|
Thermo Scientific Chemicals
109240010 |
1 g | Glasflasche |
97.18 €
1 Gramm |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | ||||
|
10349283
|
Thermo Scientific Chemicals
109240050 |
5 g | Glasflasche |
242.21 €
5 Gramm |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | ||||
Beschreibung
Dieses Markenprodukt von Thermo Scientific Chemicals war ursprünglich Teil des Produktportfolios von Acros Organics. Auf einigen Dokumenten und Etiketteninformationen steht möglicherweise noch die bisherige Marke. Die ursprüngliche Produkt- oder Artikelnummer von Acros Organics oder die SKU-Referenz wurde bei Übernahme der Marke durch Thermo Scientific Chemicals nicht geändert.
Chemische Identifikatoren
| 327-97-9 | |
| 354.31 | |
| CWVRJTMFETXNAD-JUHZACGLSA-N | |
| 1794427 | |
| (1S,3R,4R,5R)-3-[(E)-3-(3,4-Dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-Trihydroxycyclohexan-1-Carbonsäure |
| C16H18O9 | |
| MFCD00003862 | |
| chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri | |
| CHEBI:16112 | |
| O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O |
Spezifikation
| Chlorogenic acid | |
| 327-97-9 | |
| Weiß | |
| 97.5% min. (HPLC) | |
| MFCD00003862 | |
| 15, 2143 | |
| chlorogenic acid, 3-caffeoylquinic acid, chlorogenate, 3-o-caffeoylquinic acid, 3-3,4-dihydroxycinnamoyl quinic acid, heriguard, hlorogenic acid, caffeoyl quinic acid, 3-caffeoylquinate, unii-318adp12ri | |
| CWVRJTMFETXNAD-JUHZACGLSA-N | |
| (1S,3R,4R,5R)-3-[(E)-3-(3,4-Dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-Trihydroxycyclohexan-1-Carbonsäure | |
| 1794427 | |
| 354.3 | |
| Pulver, Kristalle, Ndaeln und/oder Stückchen |
| Predominantly trans, From coffee seeds | |
| 205.0°C to 209.0°C | |
| Echt | |
| C16H18O9 | |
| 10, I, 271 | |
| -36 | |
| Solubility in water: soluble in hot water. Other solubilities: soluble in alcohol and acetone | |
| O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O | |
| 354.31 | |
| CHEBI:16112 | |
| 98% |
Sicherheit und Handhabung
missing translation for 'einecsNumber' : 206-325-6
Produktidentifikator
- Chlorogenic acid, predominantly trans (ex coffee seeds)
RUO – Research Use Only
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts